C46H78N10 — CID 123533832
6,28,45,48,49,50,51,54,55,56-decazatridecacyclo[31.11.4.411,23.113,16.118,21.135,38.140,43.04,46.05,29.07,27.030,47.08,53.026,52]hexapentacontane (PubChem CID 123533832) has the molecular formula C46H78N10 and a molecular weight of 771.20 g/mol. Its IUPAC name is 6,28,45,48,49,50,51,54,55,56-decazatridecacyclo[31.11.4.411,23.113,16.118,21.135,38.140,43.04,46.05,29.07,27.030,47.08,53.026,52]hexapentacontane.
| Compound Name | 6,28,45,48,49,50,51,54,55,56-decazatridecacyclo[31.11.4.411,23.113,16.118,21.135,38.140,43.04,46.05,29.07,27.030,47.08,53.026,52]hexapentacontane |
|---|---|
| PubChem CID | 123533832 |
| Molecular Formula | C46H78N10 |
| Molecular Weight | 771.20 g/mol |
| Exact Mass | 770.64 |
| IUPAC Name | 6,28,45,48,49,50,51,54,55,56-decazatridecacyclo[31.11.4.411,23.113,16.118,21.135,38.140,43.04,46.05,29.07,27.030,47.08,53.026,52]hexapentacontane |
| SMILES | C1CC2CC3CCC4C(N3)C3NC(CCC3C3NC5C6CCC7CC8CCC(CC9CCC(CC%10CCC(C(N%10)C6N7)C5NC43)N9)N8)CC3CCC(CC1N2)N3 |
| InChI | InChI=1S/C46H78N10/c1-5-27-19-31-9-13-35-39(51-31)40-36(14-10-32(52-40)20-28-6-2-24(48-28)17-23(1)47-27)44-43(35)55-45-37-15-11-33-21-29-7-3-25(49-29)18-26-4-8-30(50-26)22-34-12-16-38(46(45)56-44)42(54-34)41(37)53-33/h23-56H,1-22H2 |
| InChIKey | OVTSJEMVTUJZNL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |