About N-formyl-N-(2,2,2-trifluoroethyl)cyclohexanecarboxamide
N-formyl-N-(2,2,2-trifluoroethyl)cyclohexanecarboxamide (PubChem CID 123534232) has the molecular formula C10H14F3NO2
and a molecular weight of 237.22 g/mol. Its IUPAC name is N-formyl-N-(2,2,2-trifluoroethyl)cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-formyl-N-(2,2,2-trifluoroethyl)cyclohexanecarboxamide |
| PubChem CID | 123534232 |
| Molecular Formula | C10H14F3NO2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-formyl-N-(2,2,2-trifluoroethyl)cyclohexanecarboxamide |
| SMILES | O=CN(CC(F)(F)F)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C10H14F3NO2/c11-10(12,13)6-14(7-15)9(16)8-4-2-1-3-5-8/h7-8H,1-6H2 |
| InChIKey | RIQMGPPPVOYZQF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-formyl-N-(2,2,2-trifluoroethyl)cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-formyl-N-(2,2,2-trifluoroethyl)cyclohexanecarboxamide?
The IUPAC name of N-formyl-N-(2,2,2-trifluoroethyl)cyclohexanecarboxamide (CID 123534232) is N-formyl-N-(2,2,2-trifluoroethyl)cyclohexanecarboxamide.
What is the SMILES notation for N-formyl-N-(2,2,2-trifluoroethyl)cyclohexanecarboxamide?
The canonical SMILES for N-formyl-N-(2,2,2-trifluoroethyl)cyclohexanecarboxamide is O=CN(CC(F)(F)F)C(=O)C1CCCCC1.
What is the InChIKey of N-formyl-N-(2,2,2-trifluoroethyl)cyclohexanecarboxamide?
The InChIKey is RIQMGPPPVOYZQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3NO2/c11-10(12,13)6-14(7-15)9(16)8-4-2-1-3-5-8/h7-8H,1-6H2.
What are the key properties of N-formyl-N-(2,2,2-trifluoroethyl)cyclohexanecarboxamide?
N-formyl-N-(2,2,2-trifluoroethyl)cyclohexanecarboxamide has a molecular weight of 237.22 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-formyl-N-(2,2,2-trifluoroethyl)cyclohexanecarboxamide is sourced from PubChem (CID 123534232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).