C22H25N3O — CID 123534727
1-cyclopropyl-5-[2-(8-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-5-yl)ethyl]pyridin-2-one (PubChem CID 123534727) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is 1-cyclopropyl-5-[2-(8-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-5-yl)ethyl]pyridin-2-one.
| Compound Name | 1-cyclopropyl-5-[2-(8-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-5-yl)ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 123534727 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-cyclopropyl-5-[2-(8-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-5-yl)ethyl]pyridin-2-one |
| SMILES | Cc1ccc2c(c1)c1c(n2CCc2ccc(=O)n(C3CC3)c2)CCNC1 |
| InChI | InChI=1S/C22H25N3O/c1-15-2-6-20-18(12-15)19-13-23-10-8-21(19)24(20)11-9-16-3-7-22(26)25(14-16)17-4-5-17/h2-3,6-7,12,14,17,23H,4-5,8-11,13H2,1H3 |
| InChIKey | WGNGRHQHUVCQFM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|