About 2-(5-fluorohexa-1,3,5-trien-3-yloxymethyl)furan
2-(5-fluorohexa-1,3,5-trien-3-yloxymethyl)furan (PubChem CID 123534880) has the molecular formula C11H11FO2
and a molecular weight of 194.20 g/mol. Its IUPAC name is 2-(5-fluorohexa-1,3,5-trien-3-yloxymethyl)furan.
Molecular Properties
| Compound Name | 2-(5-fluorohexa-1,3,5-trien-3-yloxymethyl)furan |
| PubChem CID | 123534880 |
| Molecular Formula | C11H11FO2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 2-(5-fluorohexa-1,3,5-trien-3-yloxymethyl)furan |
| SMILES | C=CC(=CC(=C)F)OCc1ccco1 |
| InChI | InChI=1S/C11H11FO2/c1-3-10(7-9(2)12)14-8-11-5-4-6-13-11/h3-7H,1-2,8H2 |
| InChIKey | WSMISTMDGSXWIL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-fluorohexa-1,3,5-trien-3-yloxymethyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-fluorohexa-1,3,5-trien-3-yloxymethyl)furan?
The IUPAC name of 2-(5-fluorohexa-1,3,5-trien-3-yloxymethyl)furan (CID 123534880) is 2-(5-fluorohexa-1,3,5-trien-3-yloxymethyl)furan.
What is the SMILES notation for 2-(5-fluorohexa-1,3,5-trien-3-yloxymethyl)furan?
The canonical SMILES for 2-(5-fluorohexa-1,3,5-trien-3-yloxymethyl)furan is C=CC(=CC(=C)F)OCc1ccco1.
What is the InChIKey of 2-(5-fluorohexa-1,3,5-trien-3-yloxymethyl)furan?
The InChIKey is WSMISTMDGSXWIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FO2/c1-3-10(7-9(2)12)14-8-11-5-4-6-13-11/h3-7H,1-2,8H2.
What are the key properties of 2-(5-fluorohexa-1,3,5-trien-3-yloxymethyl)furan?
2-(5-fluorohexa-1,3,5-trien-3-yloxymethyl)furan has a molecular weight of 194.20 g/mol, XLogP of 3.35, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-fluorohexa-1,3,5-trien-3-yloxymethyl)furan is sourced from PubChem (CID 123534880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).