C29H44N2OS — CID 123535175
2-[methyl-[[4-[[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]methyl]cycloheptyl]methyl]amino]ethanol (PubChem CID 123535175) has the molecular formula C29H44N2OS and a molecular weight of 468.75 g/mol. Its IUPAC name is 2-[methyl-[[4-[[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]methyl]cycloheptyl]methyl]amino]ethanol.
| Compound Name | 2-[methyl-[[4-[[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]methyl]cycloheptyl]methyl]amino]ethanol |
|---|---|
| PubChem CID | 123535175 |
| Molecular Formula | C29H44N2OS |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | 2-[methyl-[[4-[[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]methyl]cycloheptyl]methyl]amino]ethanol |
| SMILES | CN(CCO)CC1CCCC(Cc2nc(-c3ccc4c(c3)C(C)(C)CCC4(C)C)cs2)CC1 |
| InChI | InChI=1S/C29H44N2OS/c1-28(2)13-14-29(3,4)25-18-23(11-12-24(25)28)26-20-33-27(30-26)17-21-7-6-8-22(10-9-21)19-31(5)15-16-32/h11-12,18,20-22,32H,6-10,13-17,19H2,1-5H3 |
| InChIKey | OZDQRSUBOWWGSE-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |