C24H33N3O4 — CID 123535248
1,3'-diethyl-7a-hydroxy-3a-(5-methoxy-2-methylphenyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione (PubChem CID 123535248) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is 1,3'-diethyl-7a-hydroxy-3a-(5-methoxy-2-methylphenyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione.
| Compound Name | 1,3'-diethyl-7a-hydroxy-3a-(5-methoxy-2-methylphenyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 123535248 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 1,3'-diethyl-7a-hydroxy-3a-(5-methoxy-2-methylphenyl)spiro[2a,3,4,6,7,7b-hexahydro-2H-indeno[1,2-b]azete-5,5'-imidazolidine]-2',4'-dione |
| SMILES | CCN1C(=O)NC2(CCC3(O)C4C(CN4CC)CC3(c3cc(OC)ccc3C)C2)C1=O |
| InChI | InChI=1S/C24H33N3O4/c1-5-26-13-16-12-22(18-11-17(31-4)8-7-15(18)3)14-23(9-10-24(22,30)19(16)26)20(28)27(6-2)21(29)25-23/h7-8,11,16,19,30H,5-6,9-10,12-14H2,1-4H3,(H,25,29) |
| InChIKey | XNLUUIDHBOMYJT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|