About 2-hydroxyethyl 2-hydroxy-4-[hydroxy-(3,4,5-trihydroxycyclohexyl)methyl]peroxycyclohexane-1-carboxylate
2-hydroxyethyl 2-hydroxy-4-[hydroxy-(3,4,5-trihydroxycyclohexyl)methyl]peroxycyclohexane-1-carboxylate (PubChem CID 123535288) has the molecular formula C16H28O10
and a molecular weight of 380.39 g/mol. Its IUPAC name is 2-hydroxyethyl 2-hydroxy-4-[hydroxy-(3,4,5-trihydroxycyclohexyl)methyl]peroxycyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 2-hydroxy-4-[hydroxy-(3,4,5-trihydroxycyclohexyl)methyl]peroxycyclohexane-1-carboxylate |
| PubChem CID | 123535288 |
| Molecular Formula | C16H28O10 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-hydroxyethyl 2-hydroxy-4-[hydroxy-(3,4,5-trihydroxycyclohexyl)methyl]peroxycyclohexane-1-carboxylate |
| SMILES | O=C(OCCO)C1CCC(OOC(O)C2CC(O)C(O)C(O)C2)CC1O |
| InChI | InChI=1S/C16H28O10/c17-3-4-24-16(23)10-2-1-9(7-11(10)18)25-26-15(22)8-5-12(19)14(21)13(20)6-8/h8-15,17-22H,1-7H2 |
| InChIKey | JBVYQHPXNZPILP-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 2-hydroxy-4-[hydroxy-(3,4,5-trihydroxycyclohexyl)methyl]peroxycyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 2-hydroxy-4-[hydroxy-(3,4,5-trihydroxycyclohexyl)methyl]peroxycyclohexane-1-carboxylate?
The IUPAC name of 2-hydroxyethyl 2-hydroxy-4-[hydroxy-(3,4,5-trihydroxycyclohexyl)methyl]peroxycyclohexane-1-carboxylate (CID 123535288) is 2-hydroxyethyl 2-hydroxy-4-[hydroxy-(3,4,5-trihydroxycyclohexyl)methyl]peroxycyclohexane-1-carboxylate.
What is the SMILES notation for 2-hydroxyethyl 2-hydroxy-4-[hydroxy-(3,4,5-trihydroxycyclohexyl)methyl]peroxycyclohexane-1-carboxylate?
The canonical SMILES for 2-hydroxyethyl 2-hydroxy-4-[hydroxy-(3,4,5-trihydroxycyclohexyl)methyl]peroxycyclohexane-1-carboxylate is O=C(OCCO)C1CCC(OOC(O)C2CC(O)C(O)C(O)C2)CC1O.
What is the InChIKey of 2-hydroxyethyl 2-hydroxy-4-[hydroxy-(3,4,5-trihydroxycyclohexyl)methyl]peroxycyclohexane-1-carboxylate?
The InChIKey is JBVYQHPXNZPILP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O10/c17-3-4-24-16(23)10-2-1-9(7-11(10)18)25-26-15(22)8-5-12(19)14(21)13(20)6-8/h8-15,17-22H,1-7H2.
What are the key properties of 2-hydroxyethyl 2-hydroxy-4-[hydroxy-(3,4,5-trihydroxycyclohexyl)methyl]peroxycyclohexane-1-carboxylate?
2-hydroxyethyl 2-hydroxy-4-[hydroxy-(3,4,5-trihydroxycyclohexyl)methyl]peroxycyclohexane-1-carboxylate has a molecular weight of 380.39 g/mol, XLogP of -2.19, 7 rotatable bonds, 6 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-hydroxy-4-[hydroxy-(3,4,5-trihydroxycyclohexyl)methyl]peroxycyclohexane-1-carboxylate is sourced from PubChem (CID 123535288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).