C24H34N6O3Si — CID 123536022
4-[4-[10,12-dioxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]piperidin-1-yl]butanenitrile (PubChem CID 123536022) has the molecular formula C24H34N6O3Si and a molecular weight of 482.66 g/mol. Its IUPAC name is 4-[4-[10,12-dioxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]piperidin-1-yl]butanenitrile.
| Compound Name | 4-[4-[10,12-dioxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]piperidin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 123536022 |
| Molecular Formula | C24H34N6O3Si |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 4-[4-[10,12-dioxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]piperidin-1-yl]butanenitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c1ncc1c(=O)[nH]c(=O)n(C3CCN(CCCC#N)CC3)c12 |
| InChI | InChI=1S/C24H34N6O3Si/c1-34(2,3)15-14-33-17-29-13-8-19-21-20(16-26-22(19)29)23(31)27-24(32)30(21)18-6-11-28(12-7-18)10-5-4-9-25/h8,13,16,18H,4-7,10-12,14-15,17H2,1-3H3,(H,27,31,32) |
| InChIKey | CQOFHCACSFNKQY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|