About tert-butyl(3,3-dimethylpent-4-enyl)silane
tert-butyl(3,3-dimethylpent-4-enyl)silane (PubChem CID 123536155) has the molecular formula C11H24Si
and a molecular weight of 184.40 g/mol. Its IUPAC name is tert-butyl(3,3-dimethylpent-4-enyl)silane.
Molecular Properties
| Compound Name | tert-butyl(3,3-dimethylpent-4-enyl)silane |
| PubChem CID | 123536155 |
| Molecular Formula | C11H24Si |
| Molecular Weight | 184.40 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | tert-butyl(3,3-dimethylpent-4-enyl)silane |
| SMILES | C=CC(C)(C)CC[SiH2]C(C)(C)C |
| InChI | InChI=1S/C11H24Si/c1-7-11(5,6)8-9-12-10(2,3)4/h7H,1,8-9,12H2,2-6H3 |
| InChIKey | DMYWXZBENMBIEX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl(3,3-dimethylpent-4-enyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl(3,3-dimethylpent-4-enyl)silane?
The IUPAC name of tert-butyl(3,3-dimethylpent-4-enyl)silane (CID 123536155) is tert-butyl(3,3-dimethylpent-4-enyl)silane.
What is the SMILES notation for tert-butyl(3,3-dimethylpent-4-enyl)silane?
The canonical SMILES for tert-butyl(3,3-dimethylpent-4-enyl)silane is C=CC(C)(C)CC[SiH2]C(C)(C)C.
What is the InChIKey of tert-butyl(3,3-dimethylpent-4-enyl)silane?
The InChIKey is DMYWXZBENMBIEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24Si/c1-7-11(5,6)8-9-12-10(2,3)4/h7H,1,8-9,12H2,2-6H3.
What are the key properties of tert-butyl(3,3-dimethylpent-4-enyl)silane?
tert-butyl(3,3-dimethylpent-4-enyl)silane has a molecular weight of 184.40 g/mol, XLogP of 3.39, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl(3,3-dimethylpent-4-enyl)silane is sourced from PubChem (CID 123536155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).