C23H28N2O2S — CID 123536208
5-(4-aminophenyl)-3-(5-cyclohexyl-1-methyl-3,6-dihydro-2H-pyridin-4-yl)thiophene-2-carboxylic acid (PubChem CID 123536208) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is 5-(4-aminophenyl)-3-(5-cyclohexyl-1-methyl-3,6-dihydro-2H-pyridin-4-yl)thiophene-2-carboxylic acid.
| Compound Name | 5-(4-aminophenyl)-3-(5-cyclohexyl-1-methyl-3,6-dihydro-2H-pyridin-4-yl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 123536208 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 5-(4-aminophenyl)-3-(5-cyclohexyl-1-methyl-3,6-dihydro-2H-pyridin-4-yl)thiophene-2-carboxylic acid |
| SMILES | CN1CCC(c2cc(-c3ccc(N)cc3)sc2C(=O)O)=C(C2CCCCC2)C1 |
| InChI | InChI=1S/C23H28N2O2S/c1-25-12-11-18(20(14-25)15-5-3-2-4-6-15)19-13-21(28-22(19)23(26)27)16-7-9-17(24)10-8-16/h7-10,13,15H,2-6,11-12,14,24H2,1H3,(H,26,27) |
| InChIKey | MJLDZJXKEQQEOC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|