C6H3ClF6 — CID 123536226
3-chloro-1,1,1,6,6,6-hexafluorohexa-2,4-diene (PubChem CID 123536226) has the molecular formula C6H3ClF6 and a molecular weight of 224.53 g/mol. Its IUPAC name is 3-chloro-1,1,1,6,6,6-hexafluorohexa-2,4-diene.
| Compound Name | 3-chloro-1,1,1,6,6,6-hexafluorohexa-2,4-diene |
|---|---|
| PubChem CID | 123536226 |
| Molecular Formula | C6H3ClF6 |
| Molecular Weight | 224.53 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | 3-chloro-1,1,1,6,6,6-hexafluorohexa-2,4-diene |
| SMILES | FC(F)(F)C=CC(Cl)=CC(F)(F)F |
| InChI | InChI=1S/C6H3ClF6/c7-4(3-6(11,12)13)1-2-5(8,9)10/h1-3H |
| InChIKey | GDBBUBCGNNSRPY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|