C29H21F7N5O5S- — CID 123536739
3-[2-[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]-2-[2-(2-fluorophenyl)-3,4-dihydroimidazo[4,5-c]pyridin-5-yl]acetyl]oxypropyl sulfite (PubChem CID 123536739) has the molecular formula C29H21F7N5O5S- and a molecular weight of 684.57 g/mol. Its IUPAC name is 3-[2-[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]-2-[2-(2-fluorophenyl)-3,4-dihydroimidazo[4,5-c]pyridin-5-yl]acetyl]oxypropyl sulfite.
| Compound Name | 3-[2-[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]-2-[2-(2-fluorophenyl)-3,4-dihydroimidazo[4,5-c]pyridin-5-yl]acetyl]oxypropyl sulfite |
|---|---|
| PubChem CID | 123536739 |
| Molecular Formula | C29H21F7N5O5S- |
| Molecular Weight | 684.57 g/mol |
| Exact Mass | 684.12 |
| IUPAC Name | 3-[2-[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]-2-[2-(2-fluorophenyl)-3,4-dihydroimidazo[4,5-c]pyridin-5-yl]acetyl]oxypropyl sulfite |
| SMILES | O=C(OCCCOS(=O)[O-])C(c1ccc(-c2ccc(C(F)(F)F)cc2C(F)(F)F)nn1)N1C=Cc2nc(-c3ccccc3F)[nH]c2C1 |
| InChI | InChI=1S/C29H22F7N5O5S/c30-20-5-2-1-4-18(20)26-37-22-10-11-41(15-24(22)38-26)25(27(42)45-12-3-13-46-47(43)44)23-9-8-21(39-40-23)17-7-6-16(28(31,32)33)14-19(17)29(34,35)36/h1-2,4-11,14,25H,3,12-13,15H2,(H,37,38)(H,43,44)/p-1 |
| InChIKey | PIWBVYJVBBRGDJ-UHFFFAOYSA-M |
| XLogP | 5.98 |
| TPSA | 133.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|