C24H28FN4O2+ — CID 123536886
[4-[4-(4-fluorophenoxy)phenyl]pyrimidin-2-yl]-[2-(1-methylpyrrolidin-1-ium-1-yl)ethylamino]methanol (PubChem CID 123536886) has the molecular formula C24H28FN4O2+ and a molecular weight of 423.51 g/mol. Its IUPAC name is [4-[4-(4-fluorophenoxy)phenyl]pyrimidin-2-yl]-[2-(1-methylpyrrolidin-1-ium-1-yl)ethylamino]methanol.
| Compound Name | [4-[4-(4-fluorophenoxy)phenyl]pyrimidin-2-yl]-[2-(1-methylpyrrolidin-1-ium-1-yl)ethylamino]methanol |
|---|---|
| PubChem CID | 123536886 |
| Molecular Formula | C24H28FN4O2+ |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | [4-[4-(4-fluorophenoxy)phenyl]pyrimidin-2-yl]-[2-(1-methylpyrrolidin-1-ium-1-yl)ethylamino]methanol |
| SMILES | C[N+]1(CCNC(O)c2nccc(-c3ccc(Oc4ccc(F)cc4)cc3)n2)CCCC1 |
| InChI | InChI=1S/C24H28FN4O2/c1-29(15-2-3-16-29)17-14-27-24(30)23-26-13-12-22(28-23)18-4-8-20(9-5-18)31-21-10-6-19(25)7-11-21/h4-13,24,27,30H,2-3,14-17H2,1H3/q+1 |
| InChIKey | QIYVGAVUAXNAKC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|