About 2,3,4-trifluoro-5-methylhexa-2,4-diene
2,3,4-trifluoro-5-methylhexa-2,4-diene (PubChem CID 123537125) has the molecular formula C7H9F3
and a molecular weight of 150.14 g/mol. Its IUPAC name is 2,3,4-trifluoro-5-methylhexa-2,4-diene.
Molecular Properties
| Compound Name | 2,3,4-trifluoro-5-methylhexa-2,4-diene |
| PubChem CID | 123537125 |
| Molecular Formula | C7H9F3 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 2,3,4-trifluoro-5-methylhexa-2,4-diene |
| SMILES | CC(C)=C(F)C(F)=C(C)F |
| InChI | InChI=1S/C7H9F3/c1-4(2)6(9)7(10)5(3)8/h1-3H3 |
| InChIKey | YSBSOZKWEPKDNZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4-trifluoro-5-methylhexa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-trifluoro-5-methylhexa-2,4-diene?
The IUPAC name of 2,3,4-trifluoro-5-methylhexa-2,4-diene (CID 123537125) is 2,3,4-trifluoro-5-methylhexa-2,4-diene.
What is the SMILES notation for 2,3,4-trifluoro-5-methylhexa-2,4-diene?
The canonical SMILES for 2,3,4-trifluoro-5-methylhexa-2,4-diene is CC(C)=C(F)C(F)=C(C)F.
What is the InChIKey of 2,3,4-trifluoro-5-methylhexa-2,4-diene?
The InChIKey is YSBSOZKWEPKDNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3/c1-4(2)6(9)7(10)5(3)8/h1-3H3.
What are the key properties of 2,3,4-trifluoro-5-methylhexa-2,4-diene?
2,3,4-trifluoro-5-methylhexa-2,4-diene has a molecular weight of 150.14 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-trifluoro-5-methylhexa-2,4-diene is sourced from PubChem (CID 123537125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).