C35H41Cl3N6O6 — CID 123537131
2,2,2-trichloroethyl 1-[2-[[2-[[4-[6-(1-hydroxyethyl)isoquinolin-3-yl]-2,2-dimethylbut-3-enoyl]amino]-3-pyridin-3-ylpropanoyl]amino]propanoyl]diazinane-3-carboxylate (PubChem CID 123537131) has the molecular formula C35H41Cl3N6O6 and a molecular weight of 748.11 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 1-[2-[[2-[[4-[6-(1-hydroxyethyl)isoquinolin-3-yl]-2,2-dimethylbut-3-enoyl]amino]-3-pyridin-3-ylpropanoyl]amino]propanoyl]diazinane-3-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 1-[2-[[2-[[4-[6-(1-hydroxyethyl)isoquinolin-3-yl]-2,2-dimethylbut-3-enoyl]amino]-3-pyridin-3-ylpropanoyl]amino]propanoyl]diazinane-3-carboxylate |
|---|---|
| PubChem CID | 123537131 |
| Molecular Formula | C35H41Cl3N6O6 |
| Molecular Weight | 748.11 g/mol |
| Exact Mass | 746.22 |
| IUPAC Name | 2,2,2-trichloroethyl 1-[2-[[2-[[4-[6-(1-hydroxyethyl)isoquinolin-3-yl]-2,2-dimethylbut-3-enoyl]amino]-3-pyridin-3-ylpropanoyl]amino]propanoyl]diazinane-3-carboxylate |
| SMILES | CC(NC(=O)C(Cc1cccnc1)NC(=O)C(C)(C)C=Cc1cc2cc(C(C)O)ccc2cn1)C(=O)N1CCCC(C(=O)OCC(Cl)(Cl)Cl)N1 |
| InChI | InChI=1S/C35H41Cl3N6O6/c1-21(31(47)44-14-6-8-28(43-44)32(48)50-20-35(36,37)38)41-30(46)29(15-23-7-5-13-39-18-23)42-33(49)34(3,4)12-11-27-17-26-16-24(22(2)45)9-10-25(26)19-40-27/h5,7,9-13,16-19,21-22,28-29,43,45H,6,8,14-15,20H2,1-4H3,(H,41,46)(H,42,49) |
| InChIKey | ZAOVSEWUVFQSHG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 162.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.11 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|