C46H60N2O6 — CID 123537803
5,8-bis[2,6-dimethyl-4-[2-(3-methylpentan-3-yloxy)ethoxy]anilino]-1,9a-dihydroanthracene-9,10-dione (PubChem CID 123537803) has the molecular formula C46H60N2O6 and a molecular weight of 736.99 g/mol. Its IUPAC name is 5,8-bis[2,6-dimethyl-4-[2-(3-methylpentan-3-yloxy)ethoxy]anilino]-1,9a-dihydroanthracene-9,10-dione.
| Compound Name | 5,8-bis[2,6-dimethyl-4-[2-(3-methylpentan-3-yloxy)ethoxy]anilino]-1,9a-dihydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 123537803 |
| Molecular Formula | C46H60N2O6 |
| Molecular Weight | 736.99 g/mol |
| Exact Mass | 736.45 |
| IUPAC Name | 5,8-bis[2,6-dimethyl-4-[2-(3-methylpentan-3-yloxy)ethoxy]anilino]-1,9a-dihydroanthracene-9,10-dione |
| SMILES | CCC(C)(CC)OCCOc1cc(C)c(Nc2ccc(Nc3c(C)cc(OCCOC(C)(CC)CC)cc3C)c3c2C(=O)C2=CC=CCC2C3=O)c(C)c1 |
| InChI | InChI=1S/C46H60N2O6/c1-11-45(9,12-2)53-23-21-51-33-25-29(5)41(30(6)26-33)47-37-19-20-38(40-39(37)43(49)35-17-15-16-18-36(35)44(40)50)48-42-31(7)27-34(28-32(42)8)52-22-24-54-46(10,13-3)14-4/h15-17,19-20,25-28,36,47-48H,11-14,18,21-24H2,1-10H3 |
| InChIKey | LKVJUGNKHSYQNM-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.99 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|