C28H29Cl3FN3O5 — CID 123537813
2-[3-(1,3-dioxoisoindol-2-yl)propyl]-4-fluoro-N-[4-(hydroxymethyl)phenyl]-6-methyl-5-[(2,2,2-trichloroacetyl)amino]hept-3-enamide (PubChem CID 123537813) has the molecular formula C28H29Cl3FN3O5 and a molecular weight of 612.91 g/mol. Its IUPAC name is 2-[3-(1,3-dioxoisoindol-2-yl)propyl]-4-fluoro-N-[4-(hydroxymethyl)phenyl]-6-methyl-5-[(2,2,2-trichloroacetyl)amino]hept-3-enamide.
| Compound Name | 2-[3-(1,3-dioxoisoindol-2-yl)propyl]-4-fluoro-N-[4-(hydroxymethyl)phenyl]-6-methyl-5-[(2,2,2-trichloroacetyl)amino]hept-3-enamide |
|---|---|
| PubChem CID | 123537813 |
| Molecular Formula | C28H29Cl3FN3O5 |
| Molecular Weight | 612.91 g/mol |
| Exact Mass | 611.12 |
| IUPAC Name | 2-[3-(1,3-dioxoisoindol-2-yl)propyl]-4-fluoro-N-[4-(hydroxymethyl)phenyl]-6-methyl-5-[(2,2,2-trichloroacetyl)amino]hept-3-enamide |
| SMILES | CC(C)C(NC(=O)C(Cl)(Cl)Cl)C(F)=CC(CCCN1C(=O)c2ccccc2C1=O)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C28H29Cl3FN3O5/c1-16(2)23(34-27(40)28(29,30)31)22(32)14-18(24(37)33-19-11-9-17(15-36)10-12-19)6-5-13-35-25(38)20-7-3-4-8-21(20)26(35)39/h3-4,7-12,14,16,18,23,36H,5-6,13,15H2,1-2H3,(H,33,37)(H,34,40) |
| InChIKey | YJPGRYOIHCELGR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.91 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|