About [7-(aminomethyl)-2,7-dihydrooxepin-4-yl]methanediamine
[7-(aminomethyl)-2,7-dihydrooxepin-4-yl]methanediamine (PubChem CID 123538143) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is [7-(aminomethyl)-2,7-dihydrooxepin-4-yl]methanediamine.
Molecular Properties
| Compound Name | [7-(aminomethyl)-2,7-dihydrooxepin-4-yl]methanediamine |
| PubChem CID | 123538143 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | [7-(aminomethyl)-2,7-dihydrooxepin-4-yl]methanediamine |
| SMILES | NCC1C=CC(C(N)N)=CCO1 |
| InChI | InChI=1S/C8H15N3O/c9-5-7-2-1-6(8(10)11)3-4-12-7/h1-3,7-8H,4-5,9-11H2 |
| InChIKey | AIHSYCLHSBLWDJ-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [7-(aminomethyl)-2,7-dihydrooxepin-4-yl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(aminomethyl)-2,7-dihydrooxepin-4-yl]methanediamine?
The IUPAC name of [7-(aminomethyl)-2,7-dihydrooxepin-4-yl]methanediamine (CID 123538143) is [7-(aminomethyl)-2,7-dihydrooxepin-4-yl]methanediamine.
What is the SMILES notation for [7-(aminomethyl)-2,7-dihydrooxepin-4-yl]methanediamine?
The canonical SMILES for [7-(aminomethyl)-2,7-dihydrooxepin-4-yl]methanediamine is NCC1C=CC(C(N)N)=CCO1.
What is the InChIKey of [7-(aminomethyl)-2,7-dihydrooxepin-4-yl]methanediamine?
The InChIKey is AIHSYCLHSBLWDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c9-5-7-2-1-6(8(10)11)3-4-12-7/h1-3,7-8H,4-5,9-11H2.
What are the key properties of [7-(aminomethyl)-2,7-dihydrooxepin-4-yl]methanediamine?
[7-(aminomethyl)-2,7-dihydrooxepin-4-yl]methanediamine has a molecular weight of 169.23 g/mol, XLogP of -0.93, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(aminomethyl)-2,7-dihydrooxepin-4-yl]methanediamine is sourced from PubChem (CID 123538143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).