About 4-chloro-1H-pyrrolo[3,2-c]pyridin-6-amine
4-chloro-1H-pyrrolo[3,2-c]pyridin-6-amine (PubChem CID 123538306) has the molecular formula C7H6ClN3
and a molecular weight of 167.60 g/mol. Its IUPAC name is 4-chloro-1H-pyrrolo[3,2-c]pyridin-6-amine.
Molecular Properties
| Compound Name | 4-chloro-1H-pyrrolo[3,2-c]pyridin-6-amine |
| PubChem CID | 123538306 |
| Molecular Formula | C7H6ClN3 |
| Molecular Weight | 167.60 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | 4-chloro-1H-pyrrolo[3,2-c]pyridin-6-amine |
| SMILES | Nc1cc2[nH]ccc2c(Cl)n1 |
| InChI | InChI=1S/C7H6ClN3/c8-7-4-1-2-10-5(4)3-6(9)11-7/h1-3,10H,(H2,9,11) |
| InChIKey | PTYOYOYEJPGJIB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.60 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1H-pyrrolo[3,2-c]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1H-pyrrolo[3,2-c]pyridin-6-amine?
The IUPAC name of 4-chloro-1H-pyrrolo[3,2-c]pyridin-6-amine (CID 123538306) is 4-chloro-1H-pyrrolo[3,2-c]pyridin-6-amine.
What is the SMILES notation for 4-chloro-1H-pyrrolo[3,2-c]pyridin-6-amine?
The canonical SMILES for 4-chloro-1H-pyrrolo[3,2-c]pyridin-6-amine is Nc1cc2[nH]ccc2c(Cl)n1.
What is the InChIKey of 4-chloro-1H-pyrrolo[3,2-c]pyridin-6-amine?
The InChIKey is PTYOYOYEJPGJIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3/c8-7-4-1-2-10-5(4)3-6(9)11-7/h1-3,10H,(H2,9,11).
What are the key properties of 4-chloro-1H-pyrrolo[3,2-c]pyridin-6-amine?
4-chloro-1H-pyrrolo[3,2-c]pyridin-6-amine has a molecular weight of 167.60 g/mol, XLogP of 1.80, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1H-pyrrolo[3,2-c]pyridin-6-amine is sourced from PubChem (CID 123538306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).