About 3-ethoxy-2-methylhexa-2,4-dienal
3-ethoxy-2-methylhexa-2,4-dienal (PubChem CID 123538470) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 3-ethoxy-2-methylhexa-2,4-dienal.
Molecular Properties
| Compound Name | 3-ethoxy-2-methylhexa-2,4-dienal |
| PubChem CID | 123538470 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 3-ethoxy-2-methylhexa-2,4-dienal |
| SMILES | CC=CC(OCC)=C(C)C=O |
| InChI | InChI=1S/C9H14O2/c1-4-6-9(11-5-2)8(3)7-10/h4,6-7H,5H2,1-3H3 |
| InChIKey | IPIHCBRAYPPZSW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-2-methylhexa-2,4-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2-methylhexa-2,4-dienal?
The IUPAC name of 3-ethoxy-2-methylhexa-2,4-dienal (CID 123538470) is 3-ethoxy-2-methylhexa-2,4-dienal.
What is the SMILES notation for 3-ethoxy-2-methylhexa-2,4-dienal?
The canonical SMILES for 3-ethoxy-2-methylhexa-2,4-dienal is CC=CC(OCC)=C(C)C=O.
What is the InChIKey of 3-ethoxy-2-methylhexa-2,4-dienal?
The InChIKey is IPIHCBRAYPPZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-4-6-9(11-5-2)8(3)7-10/h4,6-7H,5H2,1-3H3.
What are the key properties of 3-ethoxy-2-methylhexa-2,4-dienal?
3-ethoxy-2-methylhexa-2,4-dienal has a molecular weight of 154.21 g/mol, XLogP of 2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2-methylhexa-2,4-dienal is sourced from PubChem (CID 123538470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).