C23H33N2S2+ — CID 123538635
3-ethyl-2-[5-(3-ethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-ylidene)penta-1,3-dienyl]-3a,4,5,7a-tetrahydro-1,3-benzothiazol-3-ium (PubChem CID 123538635) has the molecular formula C23H33N2S2+ and a molecular weight of 401.67 g/mol. Its IUPAC name is 3-ethyl-2-[5-(3-ethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-ylidene)penta-1,3-dienyl]-3a,4,5,7a-tetrahydro-1,3-benzothiazol-3-ium.
| Compound Name | 3-ethyl-2-[5-(3-ethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-ylidene)penta-1,3-dienyl]-3a,4,5,7a-tetrahydro-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 123538635 |
| Molecular Formula | C23H33N2S2+ |
| Molecular Weight | 401.67 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 3-ethyl-2-[5-(3-ethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-ylidene)penta-1,3-dienyl]-3a,4,5,7a-tetrahydro-1,3-benzothiazol-3-ium |
| SMILES | CCN1C(=CC=CC=CC2=[N+](CC)C3CCC=CC3S2)SC2CCCCC21 |
| InChI | InChI=1S/C23H33N2S2/c1-3-24-18-12-8-10-14-20(18)26-22(24)16-6-5-7-17-23-25(4-2)19-13-9-11-15-21(19)27-23/h5-7,10,14,16-21H,3-4,8-9,11-13,15H2,1-2H3/q+1 |
| InChIKey | UYTLMZQNJMIGNJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.67 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|