C46H72O10 — CID 123538968
(3,5-dihydroxy-1-adamantyl) 2,2-dimethylbutanoate;(8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2,2-dimethylbutanoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylbutanoate (PubChem CID 123538968) has the molecular formula C46H72O10 and a molecular weight of 785.07 g/mol. Its IUPAC name is (3,5-dihydroxy-1-adamantyl) 2,2-dimethylbutanoate;(8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2,2-dimethylbutanoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylbutanoate.
| Compound Name | (3,5-dihydroxy-1-adamantyl) 2,2-dimethylbutanoate;(8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2,2-dimethylbutanoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylbutanoate |
|---|---|
| PubChem CID | 123538968 |
| Molecular Formula | C46H72O10 |
| Molecular Weight | 785.07 g/mol |
| Exact Mass | 784.51 |
| IUPAC Name | (3,5-dihydroxy-1-adamantyl) 2,2-dimethylbutanoate;(8-methyl-8-tricyclo[5.2.1.02,6]decanyl) 2,2-dimethylbutanoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C)CC2CC1C1CCCC21.CCC(C)(C)C(=O)OC12CC3CC(O)(CC(O)(C3)C1)C2.CCC(C)C(=O)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C17H28O2.C16H26O4.C13H18O4/c1-5-16(2,3)15(18)19-17(4)10-11-9-14(17)13-8-6-7-12(11)13;1-4-13(2,3)12(17)20-16-7-11-5-14(18,9-16)8-15(19,6-11)10-16;1-3-6(2)12(14)16-10-7-4-8-9(5-7)13(15)17-11(8)10/h11-14H,5-10H2,1-4H3;11,18-19H,4-10H2,1-3H3;6-11H,3-5H2,1-2H3 |
| InChIKey | RVWZZBZXOXAHRY-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.07 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|