About [(1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 4-methylbenzenesulfonate
[(1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 4-methylbenzenesulfonate (PubChem CID 123539319) has the molecular formula C24H22N2O5S
and a molecular weight of 450.52 g/mol. Its IUPAC name is [(1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 4-methylbenzenesulfonate |
| PubChem CID | 123539319 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [(1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON=C(C(=O)C(C)(C)C)c2nc3c(ccc4ccccc43)o2)cc1 |
| InChI | InChI=1S/C24H22N2O5S/c1-15-9-12-17(13-10-15)32(28,29)31-26-21(22(27)24(2,3)4)23-25-20-18-8-6-5-7-16(18)11-14-19(20)30-23/h5-14H,1-4H3 |
| InChIKey | BCVZWEONOLWASJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 98.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 4-methylbenzenesulfonate?
The IUPAC name of [(1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 4-methylbenzenesulfonate (CID 123539319) is [(1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 4-methylbenzenesulfonate.
What is the SMILES notation for [(1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 4-methylbenzenesulfonate?
The canonical SMILES for [(1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)ON=C(C(=O)C(C)(C)C)c2nc3c(ccc4ccccc43)o2)cc1.
What is the InChIKey of [(1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 4-methylbenzenesulfonate?
The InChIKey is BCVZWEONOLWASJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O5S/c1-15-9-12-17(13-10-15)32(28,29)31-26-21(22(27)24(2,3)4)23-25-20-18-8-6-5-7-16(18)11-14-19(20)30-23/h5-14H,1-4H3.
What are the key properties of [(1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 4-methylbenzenesulfonate?
[(1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 4-methylbenzenesulfonate has a molecular weight of 450.52 g/mol, XLogP of 5.01, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(1-benzo[e][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 4-methylbenzenesulfonate is sourced from PubChem (CID 123539319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).