C28H39F3N4O6SSi — CID 123539389
[3-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]quinolin-7-yl] trifluoromethanesulfonate (PubChem CID 123539389) has the molecular formula C28H39F3N4O6SSi and a molecular weight of 644.79 g/mol. Its IUPAC name is [3-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]quinolin-7-yl] trifluoromethanesulfonate.
| Compound Name | [3-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]quinolin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 123539389 |
| Molecular Formula | C28H39F3N4O6SSi |
| Molecular Weight | 644.79 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | [3-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]quinolin-7-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)NCCCCc1ncc(-c2cnc3cc(OS(=O)(=O)C(F)(F)F)ccc3c2)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C28H39F3N4O6SSi/c1-27(2,3)40-26(36)32-12-8-7-9-25-34-18-24(35(25)19-39-13-14-43(4,5)6)21-15-20-10-11-22(16-23(20)33-17-21)41-42(37,38)28(29,30)31/h10-11,15-18H,7-9,12-14,19H2,1-6H3,(H,32,36) |
| InChIKey | JROPZCDJOLDRQY-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.79 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|