methyl 3-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzoate

C18H23N3O2 — CID 123539706

IUPACmethyl 3-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzoate
SMILESCOC(=O)c1ccc(C)c(-c2ccc(N(C)C)c(N(C)C)n2)c1
InChIInChI=1S/C18H23N3O2/c1-12-7-8-13(18(22)23-6)11-14(12)15-9-10-16(20(2)3)17(19-15)21(4)5/h7-11H,1-6H3
InChIKeyYLRRXDIXMNWAKC-UHFFFAOYSA-N
MW313.40 g/mol
LogP2.98
Rot. Bonds4

About methyl 3-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzoate

methyl 3-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzoate (PubChem CID 123539706) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is methyl 3-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzoate.

Molecular Properties

Compound Namemethyl 3-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzoate
PubChem CID123539706
Molecular FormulaC18H23N3O2
Molecular Weight313.40 g/mol
Exact Mass313.18
IUPAC Namemethyl 3-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzoate
SMILESCOC(=O)c1ccc(C)c(-c2ccc(N(C)C)c(N(C)C)n2)c1
InChIInChI=1S/C18H23N3O2/c1-12-7-8-13(18(22)23-6)11-14(12)15-9-10-16(20(2)3)17(19-15)21(4)5/h7-11H,1-6H3
InChIKeyYLRRXDIXMNWAKC-UHFFFAOYSA-N
XLogP2.98
TPSA45.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.40
LogP ≤ 52.98
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 3-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzoate?
The IUPAC name of methyl 3-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzoate (CID 123539706) is methyl 3-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzoate.
What is the SMILES notation for methyl 3-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzoate?
The canonical SMILES for methyl 3-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzoate is COC(=O)c1ccc(C)c(-c2ccc(N(C)C)c(N(C)C)n2)c1.
What is the InChIKey of methyl 3-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzoate?
The InChIKey is YLRRXDIXMNWAKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O2/c1-12-7-8-13(18(22)23-6)11-14(12)15-9-10-16(20(2)3)17(19-15)21(4)5/h7-11H,1-6H3.
What are the key properties of methyl 3-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzoate?
methyl 3-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzoate has a molecular weight of 313.40 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[5,6-bis(dimethylamino)-2-pyridinyl]-4-methylbenzoate is sourced from PubChem (CID 123539706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).