About dimethyl-[1-(2,2,2-trifluoroethanimidoyl)piperazin-2-ylidene]azanium
dimethyl-[1-(2,2,2-trifluoroethanimidoyl)piperazin-2-ylidene]azanium (PubChem CID 123539810) has the molecular formula C8H14F3N4+
and a molecular weight of 223.22 g/mol. Its IUPAC name is dimethyl-[1-(2,2,2-trifluoroethanimidoyl)piperazin-2-ylidene]azanium.
Molecular Properties
| Compound Name | dimethyl-[1-(2,2,2-trifluoroethanimidoyl)piperazin-2-ylidene]azanium |
| PubChem CID | 123539810 |
| Molecular Formula | C8H14F3N4+ |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | dimethyl-[1-(2,2,2-trifluoroethanimidoyl)piperazin-2-ylidene]azanium |
| SMILES | [H]/N=C(/N1CCNCC1=[N+](C)C)C(F)(F)F |
| InChI | InChI=1S/C8H14F3N4/c1-14(2)6-5-13-3-4-15(6)7(12)8(9,10)11/h12-13H,3-5H2,1-2H3/q+1/b12-7+ |
| InChIKey | FZCANLNJMPFOKI-KPKJPENVSA-N |
| XLogP | 0.10 |
| TPSA | 42.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-[1-(2,2,2-trifluoroethanimidoyl)piperazin-2-ylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[1-(2,2,2-trifluoroethanimidoyl)piperazin-2-ylidene]azanium?
The IUPAC name of dimethyl-[1-(2,2,2-trifluoroethanimidoyl)piperazin-2-ylidene]azanium (CID 123539810) is dimethyl-[1-(2,2,2-trifluoroethanimidoyl)piperazin-2-ylidene]azanium.
What is the SMILES notation for dimethyl-[1-(2,2,2-trifluoroethanimidoyl)piperazin-2-ylidene]azanium?
The canonical SMILES for dimethyl-[1-(2,2,2-trifluoroethanimidoyl)piperazin-2-ylidene]azanium is [H]/N=C(/N1CCNCC1=[N+](C)C)C(F)(F)F.
What is the InChIKey of dimethyl-[1-(2,2,2-trifluoroethanimidoyl)piperazin-2-ylidene]azanium?
The InChIKey is FZCANLNJMPFOKI-KPKJPENVSA-N. The full InChI is InChI=1S/C8H14F3N4/c1-14(2)6-5-13-3-4-15(6)7(12)8(9,10)11/h12-13H,3-5H2,1-2H3/q+1/b12-7+.
What are the key properties of dimethyl-[1-(2,2,2-trifluoroethanimidoyl)piperazin-2-ylidene]azanium?
dimethyl-[1-(2,2,2-trifluoroethanimidoyl)piperazin-2-ylidene]azanium has a molecular weight of 223.22 g/mol, XLogP of 0.10, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[1-(2,2,2-trifluoroethanimidoyl)piperazin-2-ylidene]azanium is sourced from PubChem (CID 123539810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).