About ethane;4-methyl-4,5,6,7-tetrahydro-1-benzofuran
ethane;4-methyl-4,5,6,7-tetrahydro-1-benzofuran (PubChem CID 123540152) has the molecular formula C13H24O
and a molecular weight of 196.33 g/mol. Its IUPAC name is ethane;4-methyl-4,5,6,7-tetrahydro-1-benzofuran.
Molecular Properties
| Compound Name | ethane;4-methyl-4,5,6,7-tetrahydro-1-benzofuran |
| PubChem CID | 123540152 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | ethane;4-methyl-4,5,6,7-tetrahydro-1-benzofuran |
| SMILES | CC.CC.CC1CCCc2occc21 |
| InChI | InChI=1S/C9H12O.2C2H6/c1-7-3-2-4-9-8(7)5-6-10-9;2*1-2/h5-7H,2-4H2,1H3;2*1-2H3 |
| InChIKey | CBJCAQXLNUCUPO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-methyl-4,5,6,7-tetrahydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-4,5,6,7-tetrahydro-1-benzofuran?
The IUPAC name of ethane;4-methyl-4,5,6,7-tetrahydro-1-benzofuran (CID 123540152) is ethane;4-methyl-4,5,6,7-tetrahydro-1-benzofuran.
What is the SMILES notation for ethane;4-methyl-4,5,6,7-tetrahydro-1-benzofuran?
The canonical SMILES for ethane;4-methyl-4,5,6,7-tetrahydro-1-benzofuran is CC.CC.CC1CCCc2occc21.
What is the InChIKey of ethane;4-methyl-4,5,6,7-tetrahydro-1-benzofuran?
The InChIKey is CBJCAQXLNUCUPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.2C2H6/c1-7-3-2-4-9-8(7)5-6-10-9;2*1-2/h5-7H,2-4H2,1H3;2*1-2H3.
What are the key properties of ethane;4-methyl-4,5,6,7-tetrahydro-1-benzofuran?
ethane;4-methyl-4,5,6,7-tetrahydro-1-benzofuran has a molecular weight of 196.33 g/mol, XLogP of 4.77, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-4,5,6,7-tetrahydro-1-benzofuran is sourced from PubChem (CID 123540152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).