About [3-(2,2-dimethylpropyl)-4,4-dimethylhexyl]-methoxysilane
[3-(2,2-dimethylpropyl)-4,4-dimethylhexyl]-methoxysilane (PubChem CID 123540189) has the molecular formula C14H32OSi
and a molecular weight of 244.49 g/mol. Its IUPAC name is [3-(2,2-dimethylpropyl)-4,4-dimethylhexyl]-methoxysilane.
Molecular Properties
| Compound Name | [3-(2,2-dimethylpropyl)-4,4-dimethylhexyl]-methoxysilane |
| PubChem CID | 123540189 |
| Molecular Formula | C14H32OSi |
| Molecular Weight | 244.49 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | [3-(2,2-dimethylpropyl)-4,4-dimethylhexyl]-methoxysilane |
| SMILES | CCC(C)(C)C(CC[SiH2]OC)CC(C)(C)C |
| InChI | InChI=1S/C14H32OSi/c1-8-14(5,6)12(9-10-16-15-7)11-13(2,3)4/h12H,8-11,16H2,1-7H3 |
| InChIKey | PGIBGPBLLROJGS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3-(2,2-dimethylpropyl)-4,4-dimethylhexyl]-methoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,2-dimethylpropyl)-4,4-dimethylhexyl]-methoxysilane?
The IUPAC name of [3-(2,2-dimethylpropyl)-4,4-dimethylhexyl]-methoxysilane (CID 123540189) is [3-(2,2-dimethylpropyl)-4,4-dimethylhexyl]-methoxysilane.
What is the SMILES notation for [3-(2,2-dimethylpropyl)-4,4-dimethylhexyl]-methoxysilane?
The canonical SMILES for [3-(2,2-dimethylpropyl)-4,4-dimethylhexyl]-methoxysilane is CCC(C)(C)C(CC[SiH2]OC)CC(C)(C)C.
What is the InChIKey of [3-(2,2-dimethylpropyl)-4,4-dimethylhexyl]-methoxysilane?
The InChIKey is PGIBGPBLLROJGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32OSi/c1-8-14(5,6)12(9-10-16-15-7)11-13(2,3)4/h12H,8-11,16H2,1-7H3.
What are the key properties of [3-(2,2-dimethylpropyl)-4,4-dimethylhexyl]-methoxysilane?
[3-(2,2-dimethylpropyl)-4,4-dimethylhexyl]-methoxysilane has a molecular weight of 244.49 g/mol, XLogP of 4.01, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,2-dimethylpropyl)-4,4-dimethylhexyl]-methoxysilane is sourced from PubChem (CID 123540189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).