C30H46FNO2 — CID 123540540
8-[2-cyclohex-3-en-1-yl-6-(3-fluorocyclohexa-2,4-dien-1-yl)-8-methoxy-1,2,3,5,6,7,8,8a-octahydroquinolin-4-yl]octan-3-ol (PubChem CID 123540540) has the molecular formula C30H46FNO2 and a molecular weight of 471.70 g/mol. Its IUPAC name is 8-[2-cyclohex-3-en-1-yl-6-(3-fluorocyclohexa-2,4-dien-1-yl)-8-methoxy-1,2,3,5,6,7,8,8a-octahydroquinolin-4-yl]octan-3-ol.
| Compound Name | 8-[2-cyclohex-3-en-1-yl-6-(3-fluorocyclohexa-2,4-dien-1-yl)-8-methoxy-1,2,3,5,6,7,8,8a-octahydroquinolin-4-yl]octan-3-ol |
|---|---|
| PubChem CID | 123540540 |
| Molecular Formula | C30H46FNO2 |
| Molecular Weight | 471.70 g/mol |
| Exact Mass | 471.35 |
| IUPAC Name | 8-[2-cyclohex-3-en-1-yl-6-(3-fluorocyclohexa-2,4-dien-1-yl)-8-methoxy-1,2,3,5,6,7,8,8a-octahydroquinolin-4-yl]octan-3-ol |
| SMILES | CCC(O)CCCCCC1=C2CC(C3C=C(F)C=CC3)CC(OC)C2NC(C2CC=CCC2)C1 |
| InChI | InChI=1S/C30H46FNO2/c1-3-26(33)16-9-5-8-13-23-19-28(21-11-6-4-7-12-21)32-30-27(23)18-24(20-29(30)34-2)22-14-10-15-25(31)17-22/h4,6,10,15,17,21-22,24,26,28-30,32-33H,3,5,7-9,11-14,16,18-20H2,1-2H3 |
| InChIKey | VNRQYYUQKULZJE-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.70 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|