C12H27N3O — CID 123540564
1-(2,5-diamino-2,5-dimethylhexan-3-yl)pyrrolidin-2-ol (PubChem CID 123540564) has the molecular formula C12H27N3O and a molecular weight of 229.37 g/mol. Its IUPAC name is 1-(2,5-diamino-2,5-dimethylhexan-3-yl)pyrrolidin-2-ol.
| Compound Name | 1-(2,5-diamino-2,5-dimethylhexan-3-yl)pyrrolidin-2-ol |
|---|---|
| PubChem CID | 123540564 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | 1-(2,5-diamino-2,5-dimethylhexan-3-yl)pyrrolidin-2-ol |
| SMILES | CC(C)(N)CC(N1CCCC1O)C(C)(C)N |
| InChI | InChI=1S/C12H27N3O/c1-11(2,13)8-9(12(3,4)14)15-7-5-6-10(15)16/h9-10,16H,5-8,13-14H2,1-4H3 |
| InChIKey | QSVCRLIUKHCBRV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |