C37H43N3O6S2 — CID 123540817
ethyl 2-[5-[[4-[4-(hydroxymethyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-2-(3-octyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)-4-oxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 123540817) has the molecular formula C37H43N3O6S2 and a molecular weight of 689.90 g/mol. Its IUPAC name is ethyl 2-[5-[[4-[4-(hydroxymethyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-2-(3-octyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)-4-oxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[5-[[4-[4-(hydroxymethyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-2-(3-octyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)-4-oxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 123540817 |
| Molecular Formula | C37H43N3O6S2 |
| Molecular Weight | 689.90 g/mol |
| Exact Mass | 689.26 |
| IUPAC Name | ethyl 2-[5-[[4-[4-(hydroxymethyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-2-(3-octyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)-4-oxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCCCCCCCN1C(=O)SC(=c2sc(=Cc3ccc4c(c3)C3CCCC3N4c3ccc(CO)cc3)c(=O)n2CC(=O)OCC)C1=O |
| InChI | InChI=1S/C37H43N3O6S2/c1-3-5-6-7-8-9-19-38-35(44)33(48-37(38)45)36-39(22-32(42)46-4-2)34(43)31(47-36)21-25-15-18-30-28(20-25)27-11-10-12-29(27)40(30)26-16-13-24(23-41)14-17-26/h13-18,20-21,27,29,41H,3-12,19,22-23H2,1-2H3 |
| InChIKey | BJYZIDYTZSLZOS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.90 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|