About 5-amino-1-(2,5-dimethoxyphenyl)-4-(4-methyl-1H-benzimidazol-2-yl)pyrrol-3-ol
5-amino-1-(2,5-dimethoxyphenyl)-4-(4-methyl-1H-benzimidazol-2-yl)pyrrol-3-ol (PubChem CID 123541462) has the molecular formula C20H20N4O3
and a molecular weight of 364.41 g/mol. Its IUPAC name is 5-amino-1-(2,5-dimethoxyphenyl)-4-(4-methyl-1H-benzimidazol-2-yl)pyrrol-3-ol.
Molecular Properties
| Compound Name | 5-amino-1-(2,5-dimethoxyphenyl)-4-(4-methyl-1H-benzimidazol-2-yl)pyrrol-3-ol |
| PubChem CID | 123541462 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 5-amino-1-(2,5-dimethoxyphenyl)-4-(4-methyl-1H-benzimidazol-2-yl)pyrrol-3-ol |
| SMILES | COc1ccc(OC)c(-n2cc(O)c(-c3nc4c(C)cccc4[nH]3)c2N)c1 |
| InChI | InChI=1S/C20H20N4O3/c1-11-5-4-6-13-18(11)23-20(22-13)17-15(25)10-24(19(17)21)14-9-12(26-2)7-8-16(14)27-3/h4-10,25H,21H2,1-3H3,(H,22,23) |
| InChIKey | CAPNQMMFDHVHLT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-1-(2,5-dimethoxyphenyl)-4-(4-methyl-1H-benzimidazol-2-yl)pyrrol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-(2,5-dimethoxyphenyl)-4-(4-methyl-1H-benzimidazol-2-yl)pyrrol-3-ol?
The IUPAC name of 5-amino-1-(2,5-dimethoxyphenyl)-4-(4-methyl-1H-benzimidazol-2-yl)pyrrol-3-ol (CID 123541462) is 5-amino-1-(2,5-dimethoxyphenyl)-4-(4-methyl-1H-benzimidazol-2-yl)pyrrol-3-ol.
What is the SMILES notation for 5-amino-1-(2,5-dimethoxyphenyl)-4-(4-methyl-1H-benzimidazol-2-yl)pyrrol-3-ol?
The canonical SMILES for 5-amino-1-(2,5-dimethoxyphenyl)-4-(4-methyl-1H-benzimidazol-2-yl)pyrrol-3-ol is COc1ccc(OC)c(-n2cc(O)c(-c3nc4c(C)cccc4[nH]3)c2N)c1.
What is the InChIKey of 5-amino-1-(2,5-dimethoxyphenyl)-4-(4-methyl-1H-benzimidazol-2-yl)pyrrol-3-ol?
The InChIKey is CAPNQMMFDHVHLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O3/c1-11-5-4-6-13-18(11)23-20(22-13)17-15(25)10-24(19(17)21)14-9-12(26-2)7-8-16(14)27-3/h4-10,25H,21H2,1-3H3,(H,22,23).
What are the key properties of 5-amino-1-(2,5-dimethoxyphenyl)-4-(4-methyl-1H-benzimidazol-2-yl)pyrrol-3-ol?
5-amino-1-(2,5-dimethoxyphenyl)-4-(4-methyl-1H-benzimidazol-2-yl)pyrrol-3-ol has a molecular weight of 364.41 g/mol, XLogP of 3.63, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-(2,5-dimethoxyphenyl)-4-(4-methyl-1H-benzimidazol-2-yl)pyrrol-3-ol is sourced from PubChem (CID 123541462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).