C27H20N2O6 — CID 123542263
3-[2,6-dihydroxy-3a-methyl-3-(2-oxo-1H-indol-3-ylidene)-8aH-furo[2,3-f][1]benzofuran-7-ylidene]-1H-indol-2-one (PubChem CID 123542263) has the molecular formula C27H20N2O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is 3-[2,6-dihydroxy-3a-methyl-3-(2-oxo-1H-indol-3-ylidene)-8aH-furo[2,3-f][1]benzofuran-7-ylidene]-1H-indol-2-one.
| Compound Name | 3-[2,6-dihydroxy-3a-methyl-3-(2-oxo-1H-indol-3-ylidene)-8aH-furo[2,3-f][1]benzofuran-7-ylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 123542263 |
| Molecular Formula | C27H20N2O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 3-[2,6-dihydroxy-3a-methyl-3-(2-oxo-1H-indol-3-ylidene)-8aH-furo[2,3-f][1]benzofuran-7-ylidene]-1H-indol-2-one |
| SMILES | CC12C=C3OC(O)C(=C4C(=O)Nc5ccccc54)C3=CC1OC(O)C2=C1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C27H20N2O6/c1-27-11-17-14(20(25(32)34-17)19-12-6-2-4-8-15(12)28-23(19)30)10-18(27)35-26(33)22(27)21-13-7-3-5-9-16(13)29-24(21)31/h2-11,18,25-26,32-33H,1H3,(H,28,30)(H,29,31) |
| InChIKey | GOVBUGMTGXSQHG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|