C9H17NO3 — CID 123542351
(3S)-N-cyclopropyl-2,3-dihydroxyhexanamide (PubChem CID 123542351) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is (3S)-N-cyclopropyl-2,3-dihydroxyhexanamide.
| Compound Name | (3S)-N-cyclopropyl-2,3-dihydroxyhexanamide |
|---|---|
| PubChem CID | 123542351 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (3S)-N-cyclopropyl-2,3-dihydroxyhexanamide |
| SMILES | CCC[C@H](O)C(O)C(=O)NC1CC1 |
| InChI | InChI=1S/C9H17NO3/c1-2-3-7(11)8(12)9(13)10-6-4-5-6/h6-8,11-12H,2-5H2,1H3,(H,10,13)/t7-,8?/m0/s1 |
| InChIKey | DDFNHMXAXLRPPZ-JAMMHHFISA-N |
| XLogP | -0.21 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |