C19H16ClF3N4O3 — CID 123542420
4-chloro-6-[5-(2,2,2-trifluoroethoxyimino)-7,8-dihydro-6H-naphthalen-2-yl]-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-5-one (PubChem CID 123542420) has the molecular formula C19H16ClF3N4O3 and a molecular weight of 440.81 g/mol. Its IUPAC name is 4-chloro-6-[5-(2,2,2-trifluoroethoxyimino)-7,8-dihydro-6H-naphthalen-2-yl]-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-5-one.
| Compound Name | 4-chloro-6-[5-(2,2,2-trifluoroethoxyimino)-7,8-dihydro-6H-naphthalen-2-yl]-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-5-one |
|---|---|
| PubChem CID | 123542420 |
| Molecular Formula | C19H16ClF3N4O3 |
| Molecular Weight | 440.81 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 4-chloro-6-[5-(2,2,2-trifluoroethoxyimino)-7,8-dihydro-6H-naphthalen-2-yl]-7,8-dihydropyrimido[5,4-f][1,4]oxazepin-5-one |
| SMILES | O=C1c2c(Cl)ncnc2OCCN1c1ccc2c(c1)CCCC2=NOCC(F)(F)F |
| InChI | InChI=1S/C19H16ClF3N4O3/c20-16-15-17(25-10-24-16)29-7-6-27(18(15)28)12-4-5-13-11(8-12)2-1-3-14(13)26-30-9-19(21,22)23/h4-5,8,10H,1-3,6-7,9H2 |
| InChIKey | OUDIEZPLCYMAGU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 76.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.81 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|