C18H16F6 — CID 123542451
1-methyl-2-[2-[2-methyl-4-(trifluoromethyl)phenyl]ethyl]-4-(trifluoromethyl)benzene (PubChem CID 123542451) has the molecular formula C18H16F6 and a molecular weight of 346.31 g/mol. Its IUPAC name is 1-methyl-2-[2-[2-methyl-4-(trifluoromethyl)phenyl]ethyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-methyl-2-[2-[2-methyl-4-(trifluoromethyl)phenyl]ethyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 123542451 |
| Molecular Formula | C18H16F6 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-methyl-2-[2-[2-methyl-4-(trifluoromethyl)phenyl]ethyl]-4-(trifluoromethyl)benzene |
| SMILES | Cc1cc(C(F)(F)F)ccc1CCc1cc(C(F)(F)F)ccc1C |
| InChI | InChI=1S/C18H16F6/c1-11-3-7-16(18(22,23)24)10-14(11)5-4-13-6-8-15(9-12(13)2)17(19,20)21/h3,6-10H,4-5H2,1-2H3 |
| InChIKey | TVFSFFDOJBMBKK-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |