C29H36N4O2 — CID 123543108
methyl 3-cyano-4-propan-2-yloxy-N-[1-[1-(2-pyrrolidin-1-ylethylamino)-2,3-dihydro-1H-inden-4-yl]ethenyl]benzenecarboximidate (PubChem CID 123543108) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is methyl 3-cyano-4-propan-2-yloxy-N-[1-[1-(2-pyrrolidin-1-ylethylamino)-2,3-dihydro-1H-inden-4-yl]ethenyl]benzenecarboximidate.
| Compound Name | methyl 3-cyano-4-propan-2-yloxy-N-[1-[1-(2-pyrrolidin-1-ylethylamino)-2,3-dihydro-1H-inden-4-yl]ethenyl]benzenecarboximidate |
|---|---|
| PubChem CID | 123543108 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | methyl 3-cyano-4-propan-2-yloxy-N-[1-[1-(2-pyrrolidin-1-ylethylamino)-2,3-dihydro-1H-inden-4-yl]ethenyl]benzenecarboximidate |
| SMILES | C=C(/N=C(\OC)c1ccc(OC(C)C)c(C#N)c1)c1cccc2c1CCC2NCCN1CCCC1 |
| InChI | InChI=1S/C29H36N4O2/c1-20(2)35-28-13-10-22(18-23(28)19-30)29(34-4)32-21(3)24-8-7-9-26-25(24)11-12-27(26)31-14-17-33-15-5-6-16-33/h7-10,13,18,20,27,31H,3,5-6,11-12,14-17H2,1-2,4H3/b32-29- |
| InChIKey | BXLWJEILWZYMEB-OVXWJCGASA-N |
| XLogP | 5.08 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|