About 4-fluorocyclohexa-1,5-diene-1-carbonyl chloride
4-fluorocyclohexa-1,5-diene-1-carbonyl chloride (PubChem CID 123543262) has the molecular formula C7H6ClFO
and a molecular weight of 160.57 g/mol. Its IUPAC name is 4-fluorocyclohexa-1,5-diene-1-carbonyl chloride.
Molecular Properties
| Compound Name | 4-fluorocyclohexa-1,5-diene-1-carbonyl chloride |
| PubChem CID | 123543262 |
| Molecular Formula | C7H6ClFO |
| Molecular Weight | 160.57 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | 4-fluorocyclohexa-1,5-diene-1-carbonyl chloride |
| SMILES | O=C(Cl)C1=CCC(F)C=C1 |
| InChI | InChI=1S/C7H6ClFO/c8-7(10)5-1-3-6(9)4-2-5/h1-3,6H,4H2 |
| InChIKey | CICMZQXSQPXDQS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.57 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorocyclohexa-1,5-diene-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorocyclohexa-1,5-diene-1-carbonyl chloride?
The IUPAC name of 4-fluorocyclohexa-1,5-diene-1-carbonyl chloride (CID 123543262) is 4-fluorocyclohexa-1,5-diene-1-carbonyl chloride.
What is the SMILES notation for 4-fluorocyclohexa-1,5-diene-1-carbonyl chloride?
The canonical SMILES for 4-fluorocyclohexa-1,5-diene-1-carbonyl chloride is O=C(Cl)C1=CCC(F)C=C1.
What is the InChIKey of 4-fluorocyclohexa-1,5-diene-1-carbonyl chloride?
The InChIKey is CICMZQXSQPXDQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClFO/c8-7(10)5-1-3-6(9)4-2-5/h1-3,6H,4H2.
What are the key properties of 4-fluorocyclohexa-1,5-diene-1-carbonyl chloride?
4-fluorocyclohexa-1,5-diene-1-carbonyl chloride has a molecular weight of 160.57 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorocyclohexa-1,5-diene-1-carbonyl chloride is sourced from PubChem (CID 123543262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).