C66H72I2N2 — CID 123543340
N-(4-iodo-2,6-diphenylphenyl)-2,4,6-tri(propan-2-yl)aniline (PubChem CID 123543340) has the molecular formula C66H72I2N2 and a molecular weight of 1147.12 g/mol. Its IUPAC name is N-(4-iodo-2,6-diphenylphenyl)-2,4,6-tri(propan-2-yl)aniline.
| Compound Name | N-(4-iodo-2,6-diphenylphenyl)-2,4,6-tri(propan-2-yl)aniline |
|---|---|
| PubChem CID | 123543340 |
| Molecular Formula | C66H72I2N2 |
| Molecular Weight | 1147.12 g/mol |
| Exact Mass | 1146.38 |
| IUPAC Name | N-(4-iodo-2,6-diphenylphenyl)-2,4,6-tri(propan-2-yl)aniline |
| SMILES | CC(C)c1cc(C(C)C)c(Nc2c(-c3ccccc3)cc(I)cc2-c2ccccc2)c(C(C)C)c1.CC(C)c1cc(C(C)C)c(Nc2c(-c3ccccc3)cc(I)cc2-c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/2C33H36IN/c2*1-21(2)26-17-28(22(3)4)32(29(18-26)23(5)6)35-33-30(24-13-9-7-10-14-24)19-27(34)20-31(33)25-15-11-8-12-16-25/h2*7-23,35H,1-6H3 |
| InChIKey | MGYSNESQTXQODC-UHFFFAOYSA-N |
| XLogP | 21.48 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1147.12 |
| LogP ≤ 5 | 21.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|