C33H35F6N3O2 — CID 123543450
N-[1-[3,5-bis(trifluoromethyl)phenyl]prop-2-enyl]-N-methyl-1-(2-methylphenyl)-6-oxo-7,7-bis(prop-2-enyl)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide (PubChem CID 123543450) has the molecular formula C33H35F6N3O2 and a molecular weight of 619.65 g/mol. Its IUPAC name is N-[1-[3,5-bis(trifluoromethyl)phenyl]prop-2-enyl]-N-methyl-1-(2-methylphenyl)-6-oxo-7,7-bis(prop-2-enyl)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | N-[1-[3,5-bis(trifluoromethyl)phenyl]prop-2-enyl]-N-methyl-1-(2-methylphenyl)-6-oxo-7,7-bis(prop-2-enyl)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123543450 |
| Molecular Formula | C33H35F6N3O2 |
| Molecular Weight | 619.65 g/mol |
| Exact Mass | 619.26 |
| IUPAC Name | N-[1-[3,5-bis(trifluoromethyl)phenyl]prop-2-enyl]-N-methyl-1-(2-methylphenyl)-6-oxo-7,7-bis(prop-2-enyl)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
| SMILES | C=CCC1(CC=C)CC2C(c3ccccc3C)N(C(=O)N(C)C(C=C)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CCN2C1=O |
| InChI | InChI=1S/C33H35F6N3O2/c1-6-13-31(14-7-2)20-27-28(25-12-10-9-11-21(25)4)42(16-15-41(27)29(31)43)30(44)40(5)26(8-3)22-17-23(32(34,35)36)19-24(18-22)33(37,38)39/h6-12,17-19,26-28H,1-3,13-16,20H2,4-5H3 |
| InChIKey | QQNJBRCFENNDPK-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.65 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|