About 2,2-difluorobut-3-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate
2,2-difluorobut-3-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 123543496) has the molecular formula C12H19F2NO4
and a molecular weight of 279.28 g/mol. Its IUPAC name is 2,2-difluorobut-3-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
Molecular Properties
| Compound Name | 2,2-difluorobut-3-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| PubChem CID | 123543496 |
| Molecular Formula | C12H19F2NO4 |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2,2-difluorobut-3-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | C=CC(F)(F)COC(=O)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H19F2NO4/c1-6-12(13,14)7-18-9(16)8(2)15-10(17)19-11(3,4)5/h6,8H,1,7H2,2-5H3,(H,15,17) |
| InChIKey | BBXXPCPEGFOQRJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluorobut-3-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluorobut-3-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
The IUPAC name of 2,2-difluorobut-3-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CID 123543496) is 2,2-difluorobut-3-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
What is the SMILES notation for 2,2-difluorobut-3-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
The canonical SMILES for 2,2-difluorobut-3-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate is C=CC(F)(F)COC(=O)C(C)NC(=O)OC(C)(C)C.
What is the InChIKey of 2,2-difluorobut-3-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
The InChIKey is BBXXPCPEGFOQRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F2NO4/c1-6-12(13,14)7-18-9(16)8(2)15-10(17)19-11(3,4)5/h6,8H,1,7H2,2-5H3,(H,15,17).
What are the key properties of 2,2-difluorobut-3-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
2,2-difluorobut-3-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate has a molecular weight of 279.28 g/mol, XLogP of 2.26, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluorobut-3-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate is sourced from PubChem (CID 123543496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).