C26H51NO3S2 — CID 123543672
6-[bis[(3-tert-butylsulfinylcyclopentyl)methyl]amino]hexan-1-ol (PubChem CID 123543672) has the molecular formula C26H51NO3S2 and a molecular weight of 489.83 g/mol. Its IUPAC name is 6-[bis[(3-tert-butylsulfinylcyclopentyl)methyl]amino]hexan-1-ol.
| Compound Name | 6-[bis[(3-tert-butylsulfinylcyclopentyl)methyl]amino]hexan-1-ol |
|---|---|
| PubChem CID | 123543672 |
| Molecular Formula | C26H51NO3S2 |
| Molecular Weight | 489.83 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | 6-[bis[(3-tert-butylsulfinylcyclopentyl)methyl]amino]hexan-1-ol |
| SMILES | CC(C)(C)S(=O)C1CCC(CN(CCCCCCO)CC2CCC(S(=O)C(C)(C)C)C2)C1 |
| InChI | InChI=1S/C26H51NO3S2/c1-25(2,3)31(29)23-13-11-21(17-23)19-27(15-9-7-8-10-16-28)20-22-12-14-24(18-22)32(30)26(4,5)6/h21-24,28H,7-20H2,1-6H3 |
| InChIKey | WDYUZBKOEQHSSC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.83 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|