C14H31N3O3 — CID 123543730
N-(5-amino-3,5-dimethylhexan-3-yl)-2-[2-(2-aminoethoxy)ethoxy]acetamide (PubChem CID 123543730) has the molecular formula C14H31N3O3 and a molecular weight of 289.42 g/mol. Its IUPAC name is N-(5-amino-3,5-dimethylhexan-3-yl)-2-[2-(2-aminoethoxy)ethoxy]acetamide.
| Compound Name | N-(5-amino-3,5-dimethylhexan-3-yl)-2-[2-(2-aminoethoxy)ethoxy]acetamide |
|---|---|
| PubChem CID | 123543730 |
| Molecular Formula | C14H31N3O3 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | N-(5-amino-3,5-dimethylhexan-3-yl)-2-[2-(2-aminoethoxy)ethoxy]acetamide |
| SMILES | CCC(C)(CC(C)(C)N)NC(=O)COCCOCCN |
| InChI | InChI=1S/C14H31N3O3/c1-5-14(4,11-13(2,3)16)17-12(18)10-20-9-8-19-7-6-15/h5-11,15-16H2,1-4H3,(H,17,18) |
| InChIKey | QXAGAHLYRDZQKT-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|