About (2-methyl-3-methylidenehexa-1,4-dienyl)diazene
(2-methyl-3-methylidenehexa-1,4-dienyl)diazene (PubChem CID 123544316) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is (2-methyl-3-methylidenehexa-1,4-dienyl)diazene.
Molecular Properties
| Compound Name | (2-methyl-3-methylidenehexa-1,4-dienyl)diazene |
| PubChem CID | 123544316 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (2-methyl-3-methylidenehexa-1,4-dienyl)diazene |
| SMILES | [H]/N=N/C=C(C)C(=C)C=CC |
| InChI | InChI=1S/C8H12N2/c1-4-5-7(2)8(3)6-10-9/h4-6,9H,2H2,1,3H3/b5-4?,8-6?,10-9+ |
| InChIKey | BFRURQPQGFVKFO-XWEMBHETSA-N |
| XLogP | 3.05 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-3-methylidenehexa-1,4-dienyl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-3-methylidenehexa-1,4-dienyl)diazene?
The IUPAC name of (2-methyl-3-methylidenehexa-1,4-dienyl)diazene (CID 123544316) is (2-methyl-3-methylidenehexa-1,4-dienyl)diazene.
What is the SMILES notation for (2-methyl-3-methylidenehexa-1,4-dienyl)diazene?
The canonical SMILES for (2-methyl-3-methylidenehexa-1,4-dienyl)diazene is [H]/N=N/C=C(C)C(=C)C=CC.
What is the InChIKey of (2-methyl-3-methylidenehexa-1,4-dienyl)diazene?
The InChIKey is BFRURQPQGFVKFO-XWEMBHETSA-N. The full InChI is InChI=1S/C8H12N2/c1-4-5-7(2)8(3)6-10-9/h4-6,9H,2H2,1,3H3/b5-4?,8-6?,10-9+.
What are the key properties of (2-methyl-3-methylidenehexa-1,4-dienyl)diazene?
(2-methyl-3-methylidenehexa-1,4-dienyl)diazene has a molecular weight of 136.20 g/mol, XLogP of 3.05, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-3-methylidenehexa-1,4-dienyl)diazene is sourced from PubChem (CID 123544316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).