About 3-(chloromethyl)-4,5-dimethyl-1,2,4-thiadiazol-4-ium
3-(chloromethyl)-4,5-dimethyl-1,2,4-thiadiazol-4-ium (PubChem CID 123544741) has the molecular formula C5H8ClN2S+
and a molecular weight of 163.65 g/mol. Its IUPAC name is 3-(chloromethyl)-4,5-dimethyl-1,2,4-thiadiazol-4-ium.
Molecular Properties
| Compound Name | 3-(chloromethyl)-4,5-dimethyl-1,2,4-thiadiazol-4-ium |
| PubChem CID | 123544741 |
| Molecular Formula | C5H8ClN2S+ |
| Molecular Weight | 163.65 g/mol |
| Exact Mass | 163.01 |
| IUPAC Name | 3-(chloromethyl)-4,5-dimethyl-1,2,4-thiadiazol-4-ium |
| SMILES | Cc1snc(CCl)[n+]1C |
| InChI | InChI=1S/C5H8ClN2S/c1-4-8(2)5(3-6)7-9-4/h3H2,1-2H3/q+1 |
| InChIKey | MYLZTOFBKTUULL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.65 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-4,5-dimethyl-1,2,4-thiadiazol-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-4,5-dimethyl-1,2,4-thiadiazol-4-ium?
The IUPAC name of 3-(chloromethyl)-4,5-dimethyl-1,2,4-thiadiazol-4-ium (CID 123544741) is 3-(chloromethyl)-4,5-dimethyl-1,2,4-thiadiazol-4-ium.
What is the SMILES notation for 3-(chloromethyl)-4,5-dimethyl-1,2,4-thiadiazol-4-ium?
The canonical SMILES for 3-(chloromethyl)-4,5-dimethyl-1,2,4-thiadiazol-4-ium is Cc1snc(CCl)[n+]1C.
What is the InChIKey of 3-(chloromethyl)-4,5-dimethyl-1,2,4-thiadiazol-4-ium?
The InChIKey is MYLZTOFBKTUULL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClN2S/c1-4-8(2)5(3-6)7-9-4/h3H2,1-2H3/q+1.
What are the key properties of 3-(chloromethyl)-4,5-dimethyl-1,2,4-thiadiazol-4-ium?
3-(chloromethyl)-4,5-dimethyl-1,2,4-thiadiazol-4-ium has a molecular weight of 163.65 g/mol, XLogP of 1.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-4,5-dimethyl-1,2,4-thiadiazol-4-ium is sourced from PubChem (CID 123544741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).