C15H24F3N — CID 123544900
3-methyl-N-[(1E,3Z)-3-methyl-2-(1,1,2-trifluoroethyl)penta-1,3-dienyl]hexan-2-imine (PubChem CID 123544900) has the molecular formula C15H24F3N and a molecular weight of 275.36 g/mol. Its IUPAC name is 3-methyl-N-[(1E,3Z)-3-methyl-2-(1,1,2-trifluoroethyl)penta-1,3-dienyl]hexan-2-imine.
| Compound Name | 3-methyl-N-[(1E,3Z)-3-methyl-2-(1,1,2-trifluoroethyl)penta-1,3-dienyl]hexan-2-imine |
|---|---|
| PubChem CID | 123544900 |
| Molecular Formula | C15H24F3N |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 3-methyl-N-[(1E,3Z)-3-methyl-2-(1,1,2-trifluoroethyl)penta-1,3-dienyl]hexan-2-imine |
| SMILES | C/C=C(C)\C(=C/N=C(\C)C(C)CCC)C(F)(F)CF |
| InChI | InChI=1S/C15H24F3N/c1-6-8-12(4)13(5)19-9-14(11(3)7-2)15(17,18)10-16/h7,9,12H,6,8,10H2,1-5H3/b11-7-,14-9+,19-13+ |
| InChIKey | KWFXJPRNIHXZFT-ZNQSSHHQSA-N |
| XLogP | 5.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|