C18H16N3O3S2+ — CID 123545118
N-(4-acetyl-1,3-thiazol-2-yl)-2-(2,3-dihydro-1-benzofuran-5-yl)-3-methyl-1,3-thiazol-3-ium-4-carboxamide (PubChem CID 123545118) has the molecular formula C18H16N3O3S2+ and a molecular weight of 386.48 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-2-(2,3-dihydro-1-benzofuran-5-yl)-3-methyl-1,3-thiazol-3-ium-4-carboxamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-2-(2,3-dihydro-1-benzofuran-5-yl)-3-methyl-1,3-thiazol-3-ium-4-carboxamide |
|---|---|
| PubChem CID | 123545118 |
| Molecular Formula | C18H16N3O3S2+ |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-2-(2,3-dihydro-1-benzofuran-5-yl)-3-methyl-1,3-thiazol-3-ium-4-carboxamide |
| SMILES | CC(=O)c1csc(NC(=O)c2csc(-c3ccc4c(c3)CCO4)[n+]2C)n1 |
| InChI | InChI=1S/C18H15N3O3S2/c1-10(22)13-8-26-18(19-13)20-16(23)14-9-25-17(21(14)2)12-3-4-15-11(7-12)5-6-24-15/h3-4,7-9H,5-6H2,1-2H3/p+1 |
| InChIKey | RLVQHPVXLDMNTD-UHFFFAOYSA-O |
| XLogP | 3.09 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|