About (4-nitroanilino) carbonochloridate
(4-nitroanilino) carbonochloridate (PubChem CID 123545253) has the molecular formula C7H5ClN2O4
and a molecular weight of 216.58 g/mol. Its IUPAC name is (4-nitroanilino) carbonochloridate.
Molecular Properties
| Compound Name | (4-nitroanilino) carbonochloridate |
| PubChem CID | 123545253 |
| Molecular Formula | C7H5ClN2O4 |
| Molecular Weight | 216.58 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | (4-nitroanilino) carbonochloridate |
| SMILES | O=C(Cl)ONc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H5ClN2O4/c8-7(11)14-9-5-1-3-6(4-2-5)10(12)13/h1-4,9H |
| InChIKey | FMEUESZFUMWEFI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.58 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitroanilino) carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitroanilino) carbonochloridate?
The IUPAC name of (4-nitroanilino) carbonochloridate (CID 123545253) is (4-nitroanilino) carbonochloridate.
What is the SMILES notation for (4-nitroanilino) carbonochloridate?
The canonical SMILES for (4-nitroanilino) carbonochloridate is O=C(Cl)ONc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitroanilino) carbonochloridate?
The InChIKey is FMEUESZFUMWEFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O4/c8-7(11)14-9-5-1-3-6(4-2-5)10(12)13/h1-4,9H.
What are the key properties of (4-nitroanilino) carbonochloridate?
(4-nitroanilino) carbonochloridate has a molecular weight of 216.58 g/mol, XLogP of 2.30, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitroanilino) carbonochloridate is sourced from PubChem (CID 123545253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).