About oct-7-en-2-yn-4-one
oct-7-en-2-yn-4-one (PubChem CID 123545269) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is oct-7-en-2-yn-4-one.
Molecular Properties
| Compound Name | oct-7-en-2-yn-4-one |
| PubChem CID | 123545269 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | oct-7-en-2-yn-4-one |
| SMILES | C=CCCC(=O)C#CC |
| InChI | InChI=1S/C8H10O/c1-3-5-7-8(9)6-4-2/h3H,1,5,7H2,2H3 |
| InChIKey | MXAJMAQJGCKIJX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze oct-7-en-2-yn-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-7-en-2-yn-4-one?
The IUPAC name of oct-7-en-2-yn-4-one (CID 123545269) is oct-7-en-2-yn-4-one.
What is the SMILES notation for oct-7-en-2-yn-4-one?
The canonical SMILES for oct-7-en-2-yn-4-one is C=CCCC(=O)C#CC.
What is the InChIKey of oct-7-en-2-yn-4-one?
The InChIKey is MXAJMAQJGCKIJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O/c1-3-5-7-8(9)6-4-2/h3H,1,5,7H2,2H3.
What are the key properties of oct-7-en-2-yn-4-one?
oct-7-en-2-yn-4-one has a molecular weight of 122.17 g/mol, XLogP of 1.54, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oct-7-en-2-yn-4-one is sourced from PubChem (CID 123545269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).