About 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enimidamide
2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enimidamide (PubChem CID 123545589) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enimidamide.
Molecular Properties
| Compound Name | 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enimidamide |
| PubChem CID | 123545589 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enimidamide |
| SMILES | [H]/N=C(\N)C(=C(C)C)/C(C)=N/C |
| InChI | InChI=1S/C8H15N3/c1-5(2)7(8(9)10)6(3)11-4/h1-4H3,(H3,9,10)/b11-6+ |
| InChIKey | ZVRYHEGAIOXKOP-IZZDOVSWSA-N |
| XLogP | 1.35 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enimidamide?
The IUPAC name of 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enimidamide (CID 123545589) is 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enimidamide.
What is the SMILES notation for 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enimidamide?
The canonical SMILES for 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enimidamide is [H]/N=C(\N)C(=C(C)C)/C(C)=N/C.
What is the InChIKey of 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enimidamide?
The InChIKey is ZVRYHEGAIOXKOP-IZZDOVSWSA-N. The full InChI is InChI=1S/C8H15N3/c1-5(2)7(8(9)10)6(3)11-4/h1-4H3,(H3,9,10)/b11-6+.
What are the key properties of 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enimidamide?
2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enimidamide has a molecular weight of 153.23 g/mol, XLogP of 1.35, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(C,N-dimethylcarbonimidoyl)-3-methylbut-2-enimidamide is sourced from PubChem (CID 123545589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).